2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole
Catalog No: FT-0636024
CAS No: 6208-60-2
- Chemical Name: 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole
- Molecular Formula: C11H12N2
- Molecular Weight: 172.23
- InChI Key: RPROHCOBMVQVIV-UHFFFAOYSA-N
- InChI: InChI=1S/C11H12N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-4,12-13H,5-7H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 172.226 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 6208-60-2 |
| Bolling_Point: | 351.6±32.0 °C at 760 mmHg |
| Product_Name: | 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole |
| Melting_Point: | N/A |
| Flash_Point: | 166.5±25.1 °C |
| MF: | C11H12N2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.33 |
| Flash_Point: | 166.5±25.1 °C |
| Refractive_Index: | 1.670 |
| FW: | 172.226 |
| PSA: | 27.82000 |
| MF: | C11H12N2 |
| Bolling_Point: | 351.6±32.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 172.100052 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)